C29H53N3O8 — CID 144781798
cis-(5S,6R,10E)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-12,13-dihydroxy-7-methoxy-3,5,11,13-tetramethyl-10-(propan-2-ylidenehydrazinylidene)-oxacyclotetradecan-2-one (PubChem CID 144781798) has the molecular formula C29H53N3O8 and a molecular weight of 571.76 g/mol. Its IUPAC name is cis-(5S,6R,10E)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-12,13-dihydroxy-7-methoxy-3,5,11,13-tetramethyl-10-(propan-2-ylidenehydrazinylidene)-oxacyclotetradecan-2-one.
| Compound Name | cis-(5S,6R,10E)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-12,13-dihydroxy-7-methoxy-3,5,11,13-tetramethyl-10-(propan-2-ylidenehydrazinylidene)-oxacyclotetradecan-2-one |
|---|---|
| PubChem CID | 144781798 |
| Molecular Formula | C29H53N3O8 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.38 |
| IUPAC Name | cis-(5S,6R,10E)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-12,13-dihydroxy-7-methoxy-3,5,11,13-tetramethyl-10-(propan-2-ylidenehydrazinylidene)-oxacyclotetradecan-2-one |
| SMILES | COC1CC/C(=N\N=C(C)C)C(C)C(O)C(C)(O)COC(=O)C(C)C[C@H](C)[C@H]1OC1OC(C)CC(N(C)C)C1O |
| InChI | InChI=1S/C29H53N3O8/c1-16(2)30-31-21-11-12-23(37-10)25(40-28-24(33)22(32(8)9)14-19(5)39-28)17(3)13-18(4)27(35)38-15-29(7,36)26(34)20(21)6/h17-20,22-26,28,33-34,36H,11-15H2,1-10H3/b31-21+/t17-,18?,19?,20?,22?,23?,24?,25+,26?,28?,29?/m0/s1 |
| InChIKey | LIEMXSVQHJVSIL-FAOFLBBWSA-N |
| XLogP | 2.40 |
| TPSA | 142.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|