C58H42N4O — CID 144781998
N-methylidene-N'-[C-phenyl-N-[[6-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]dibenzofuran-4-yl]methyl]carbonimidoyl]benzenecarboximidamide (PubChem CID 144781998) has the molecular formula C58H42N4O and a molecular weight of 811.00 g/mol. Its IUPAC name is N-methylidene-N'-[C-phenyl-N-[[6-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]dibenzofuran-4-yl]methyl]carbonimidoyl]benzenecarboximidamide.
| Compound Name | N-methylidene-N'-[C-phenyl-N-[[6-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]dibenzofuran-4-yl]methyl]carbonimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 144781998 |
| Molecular Formula | C58H42N4O |
| Molecular Weight | 811.00 g/mol |
| Exact Mass | 810.34 |
| IUPAC Name | N-methylidene-N'-[C-phenyl-N-[[6-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]dibenzofuran-4-yl]methyl]carbonimidoyl]benzenecarboximidamide |
| SMILES | C=N/C(=N\C(=N/Cc1cccc2c1oc1c(-c3ccc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)cc4)cc3)cccc12)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C58H42N4O/c1-59-57(46-20-10-4-11-21-46)61-58(47-22-12-5-13-23-47)60-40-48-24-14-26-53-54-27-15-25-52(56(54)63-55(48)53)45-32-38-51(39-33-45)62(49-34-28-43(29-35-49)41-16-6-2-7-17-41)50-36-30-44(31-37-50)42-18-8-3-9-19-42/h2-39H,1,40H2/b60-58-,61-57- |
| InChIKey | ZYSSGIDMAAXXJW-NPKSQTACSA-N |
| XLogP | 15.15 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.00 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|