About 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine
6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine (PubChem CID 144782397) has the molecular formula C19H25N
and a molecular weight of 267.42 g/mol. Its IUPAC name is 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine.
Molecular Properties
| Compound Name | 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine |
| PubChem CID | 144782397 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine |
| SMILES | CCC1(CC)Cc2ccccc2C2(C)C=CC=C(C)N12 |
| InChI | InChI=1S/C19H25N/c1-5-19(6-2)14-16-11-7-8-12-17(16)18(4)13-9-10-15(3)20(18)19/h7-13H,5-6,14H2,1-4H3 |
| InChIKey | ODROUONNIIUQRZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine?
The IUPAC name of 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine (CID 144782397) is 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine.
What is the SMILES notation for 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine?
The canonical SMILES for 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine is CCC1(CC)Cc2ccccc2C2(C)C=CC=C(C)N12.
What is the InChIKey of 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine?
The InChIKey is ODROUONNIIUQRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N/c1-5-19(6-2)14-16-11-7-8-12-17(16)18(4)13-9-10-15(3)20(18)19/h7-13H,5-6,14H2,1-4H3.
What are the key properties of 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine?
6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine has a molecular weight of 267.42 g/mol, XLogP of 4.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-diethyl-4,11b-dimethyl-7H-benzo[a]quinolizine is sourced from PubChem (CID 144782397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).