C26H29BrN4 — CID 144782448
14-bromo-13-ethyl-8-(4-ethylphenyl)-10,10-dimethyl-1,3,6,8-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,11(16),12,14-hexaene;ethene (PubChem CID 144782448) has the molecular formula C26H29BrN4 and a molecular weight of 477.45 g/mol. Its IUPAC name is 14-bromo-13-ethyl-8-(4-ethylphenyl)-10,10-dimethyl-1,3,6,8-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,11(16),12,14-hexaene;ethene.
| Compound Name | 14-bromo-13-ethyl-8-(4-ethylphenyl)-10,10-dimethyl-1,3,6,8-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,11(16),12,14-hexaene;ethene |
|---|---|
| PubChem CID | 144782448 |
| Molecular Formula | C26H29BrN4 |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 14-bromo-13-ethyl-8-(4-ethylphenyl)-10,10-dimethyl-1,3,6,8-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,11(16),12,14-hexaene;ethene |
| SMILES | C=C.CCc1ccc(N2c3nccnc3N3c4cc(Br)c(CC)cc4C(C)(C)C23)cc1 |
| InChI | InChI=1S/C24H25BrN4.C2H4/c1-5-15-7-9-17(10-8-15)28-21-22(27-12-11-26-21)29-20-14-19(25)16(6-2)13-18(20)24(3,4)23(28)29;1-2/h7-14,23H,5-6H2,1-4H3;1-2H2 |
| InChIKey | YHAFBORCIWUFOW-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|