About 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine
2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine (PubChem CID 144782548) has the molecular formula C23H28ClN3
and a molecular weight of 381.95 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine |
| PubChem CID | 144782548 |
| Molecular Formula | C23H28ClN3 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine |
| SMILES | CCCN(CCC)c1cccnc1-c1ccc(Cl)cc1.Cc1ccncc1 |
| InChI | InChI=1S/C17H21ClN2.C6H7N/c1-3-12-20(13-4-2)16-6-5-11-19-17(16)14-7-9-15(18)10-8-14;1-6-2-4-7-5-3-6/h5-11H,3-4,12-13H2,1-2H3;2-5H,1H3 |
| InChIKey | LMWZNPBVJYQLHY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine?
The IUPAC name of 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine (CID 144782548) is 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine.
What is the SMILES notation for 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine?
The canonical SMILES for 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine is CCCN(CCC)c1cccnc1-c1ccc(Cl)cc1.Cc1ccncc1.
What is the InChIKey of 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine?
The InChIKey is LMWZNPBVJYQLHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN2.C6H7N/c1-3-12-20(13-4-2)16-6-5-11-19-17(16)14-7-9-15(18)10-8-14;1-6-2-4-7-5-3-6/h5-11H,3-4,12-13H2,1-2H3;2-5H,1H3.
What are the key properties of 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine?
2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine has a molecular weight of 381.95 g/mol, XLogP of 6.42, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-N,N-dipropylpyridin-3-amine;4-methylpyridine is sourced from PubChem (CID 144782548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).