About (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile
(3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile (PubChem CID 144782774) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile.
Molecular Properties
| Compound Name | (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile |
| PubChem CID | 144782774 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C\C(=C)N(C)CCC(C)O |
| InChI | InChI=1S/C12H18N2O/c1-10(9-13)5-6-11(2)14(4)8-7-12(3)15/h5-6,12,15H,1-2,7-8H2,3-4H3/b6-5- |
| InChIKey | GHYGWPWJSPUZFP-WAYWQWQTSA-N |
| XLogP | 1.84 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile?
The IUPAC name of (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile (CID 144782774) is (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile.
What is the SMILES notation for (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile?
The canonical SMILES for (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile is C=C(C#N)/C=C\C(=C)N(C)CCC(C)O.
What is the InChIKey of (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile?
The InChIKey is GHYGWPWJSPUZFP-WAYWQWQTSA-N. The full InChI is InChI=1S/C12H18N2O/c1-10(9-13)5-6-11(2)14(4)8-7-12(3)15/h5-6,12,15H,1-2,7-8H2,3-4H3/b6-5-.
What are the key properties of (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile?
(3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile has a molecular weight of 206.29 g/mol, XLogP of 1.84, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-[3-hydroxybutyl(methyl)amino]-2-methylidenehexa-3,5-dienenitrile is sourced from PubChem (CID 144782774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).