C25H29N3O — CID 144782943
3-cyano-N-(3-heptan-4-yl-1,4-dimethylindol-5-yl)benzamide (PubChem CID 144782943) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 3-cyano-N-(3-heptan-4-yl-1,4-dimethylindol-5-yl)benzamide.
| Compound Name | 3-cyano-N-(3-heptan-4-yl-1,4-dimethylindol-5-yl)benzamide |
|---|---|
| PubChem CID | 144782943 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 3-cyano-N-(3-heptan-4-yl-1,4-dimethylindol-5-yl)benzamide |
| SMILES | CCCC(CCC)c1cn(C)c2ccc(NC(=O)c3cccc(C#N)c3)c(C)c12 |
| InChI | InChI=1S/C25H29N3O/c1-5-8-19(9-6-2)21-16-28(4)23-13-12-22(17(3)24(21)23)27-25(29)20-11-7-10-18(14-20)15-26/h7,10-14,16,19H,5-6,8-9H2,1-4H3,(H,27,29) |
| InChIKey | CYLBGCXCXPBVEC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |