C37H60S — CID 144783389
(5Z)-1-[(1Z)-buta-1,3-dienyl]-2-methyl-4-methylidene-5-prop-2-enylidenecyclohexene;ethane;(3E,5Z)-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfanylhepta-1,3,5-triene (PubChem CID 144783389) has the molecular formula C37H60S and a molecular weight of 536.95 g/mol. Its IUPAC name is (5Z)-1-[(1Z)-buta-1,3-dienyl]-2-methyl-4-methylidene-5-prop-2-enylidenecyclohexene;ethane;(3E,5Z)-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfanylhepta-1,3,5-triene.
| Compound Name | (5Z)-1-[(1Z)-buta-1,3-dienyl]-2-methyl-4-methylidene-5-prop-2-enylidenecyclohexene;ethane;(3E,5Z)-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 144783389 |
| Molecular Formula | C37H60S |
| Molecular Weight | 536.95 g/mol |
| Exact Mass | 536.44 |
| IUPAC Name | (5Z)-1-[(1Z)-buta-1,3-dienyl]-2-methyl-4-methylidene-5-prop-2-enylidenecyclohexene;ethane;(3E,5Z)-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfanylhepta-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/C)SC(/C=C\C)=C/C=C.C=C/C=C\C1=C(C)CC(=C)/C(=C\C=C)C1.CC.CC.CC.CC |
| InChI | InChI=1S/C15H18.C14H18S.4C2H6/c1-5-7-9-15-11-14(8-6-2)12(3)10-13(15)4;1-5-9-12-13(8-4)15-14(10-6-2)11-7-3;4*1-2/h5-9H,1-3,10-11H2,4H3;5-12H,1-2H2,3-4H3;4*1-2H3/b9-7-,14-8-;11-7-,12-9-,13-8+,14-10+;;;; |
| InChIKey | GRCFTRFMTIRYMR-VUUZVGDDSA-N |
| XLogP | 13.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.95 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|