C28H30N2O6S2 — CID 144783549
6,13-bis[2-(2-methoxyethoxy)ethoxy]-[1,4]benzothiazino[2,3-b]phenothiazine (PubChem CID 144783549) has the molecular formula C28H30N2O6S2 and a molecular weight of 554.69 g/mol. Its IUPAC name is 6,13-bis[2-(2-methoxyethoxy)ethoxy]-[1,4]benzothiazino[2,3-b]phenothiazine.
| Compound Name | 6,13-bis[2-(2-methoxyethoxy)ethoxy]-[1,4]benzothiazino[2,3-b]phenothiazine |
|---|---|
| PubChem CID | 144783549 |
| Molecular Formula | C28H30N2O6S2 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 6,13-bis[2-(2-methoxyethoxy)ethoxy]-[1,4]benzothiazino[2,3-b]phenothiazine |
| SMILES | COCCOCCOc1c2c(c(OCCOCCOC)c3c1=Nc1ccccc1S3)=Nc1ccccc1S2 |
| InChI | InChI=1S/C28H30N2O6S2/c1-31-11-13-33-15-17-35-25-23-28(38-22-10-6-3-7-19(22)29-23)26(36-18-16-34-14-12-32-2)24-27(25)37-21-9-5-4-8-20(21)30-24/h3-10H,11-18H2,1-2H3 |
| InChIKey | JBGUATZYWSAQIX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 80.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|