C16H23N7O2 — CID 144783809
3-cyclopropyl-N-methyl-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]aniline;N-hydrazinylformamide (PubChem CID 144783809) has the molecular formula C16H23N7O2 and a molecular weight of 345.41 g/mol. Its IUPAC name is 3-cyclopropyl-N-methyl-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]aniline;N-hydrazinylformamide.
| Compound Name | 3-cyclopropyl-N-methyl-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]aniline;N-hydrazinylformamide |
|---|---|
| PubChem CID | 144783809 |
| Molecular Formula | C16H23N7O2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 3-cyclopropyl-N-methyl-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]aniline;N-hydrazinylformamide |
| SMILES | CNc1cccc(C2CC2)c1COc1nncnc1C.NNNC=O |
| InChI | InChI=1S/C15H18N4O.CH5N3O/c1-10-15(19-18-9-17-10)20-8-13-12(11-6-7-11)4-3-5-14(13)16-2;2-4-3-1-5/h3-5,9,11,16H,6-8H2,1-2H3;1,4H,2H2,(H,3,5) |
| InChIKey | BXNJQTXVMRMEGK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|