C14H20N6O2 — CID 144783872
N,3-dimethyl-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]aniline;formohydrazide (PubChem CID 144783872) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is N,3-dimethyl-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]aniline;formohydrazide.
| Compound Name | N,3-dimethyl-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]aniline;formohydrazide |
|---|---|
| PubChem CID | 144783872 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N,3-dimethyl-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]aniline;formohydrazide |
| SMILES | CNc1cccc(C)c1COc1nncnc1C.NNC=O |
| InChI | InChI=1S/C13H16N4O.CH4N2O/c1-9-5-4-6-12(14-3)11(9)7-18-13-10(2)15-8-16-17-13;2-3-1-4/h4-6,8,14H,7H2,1-3H3;1H,2H2,(H,3,4) |
| InChIKey | VYRRKUDWQXSGOV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|