About 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine
1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine (PubChem CID 144783964) has the molecular formula C15H20BrN5O2
and a molecular weight of 382.26 g/mol. Its IUPAC name is 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine.
Molecular Properties
| Compound Name | 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine |
| PubChem CID | 144783964 |
| Molecular Formula | C15H20BrN5O2 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine |
| SMILES | CN.Cc1ncccc1OCc1c(Br)cccc1NC(=O)NN |
| InChI | InChI=1S/C14H15BrN4O2.CH5N/c1-9-13(6-3-7-17-9)21-8-10-11(15)4-2-5-12(10)18-14(20)19-16;1-2/h2-7H,8,16H2,1H3,(H2,18,19,20);2H2,1H3 |
| InChIKey | KPGCPEVSXPDZPS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine?
The IUPAC name of 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine (CID 144783964) is 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine.
What is the SMILES notation for 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine?
The canonical SMILES for 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine is CN.Cc1ncccc1OCc1c(Br)cccc1NC(=O)NN.
What is the InChIKey of 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine?
The InChIKey is KPGCPEVSXPDZPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN4O2.CH5N/c1-9-13(6-3-7-17-9)21-8-10-11(15)4-2-5-12(10)18-14(20)19-16;1-2/h2-7H,8,16H2,1H3,(H2,18,19,20);2H2,1H3.
What are the key properties of 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine?
1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine has a molecular weight of 382.26 g/mol, XLogP of 2.30, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-[3-bromo-2-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]urea;methanamine is sourced from PubChem (CID 144783964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).