C14H17F2N3O — CID 144784439
[2-(difluoromethyl)-6-(methylamino)phenyl]methyl (Z)-4-imino-2-methylbut-2-enimidate (PubChem CID 144784439) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is [2-(difluoromethyl)-6-(methylamino)phenyl]methyl (Z)-4-imino-2-methylbut-2-enimidate.
| Compound Name | [2-(difluoromethyl)-6-(methylamino)phenyl]methyl (Z)-4-imino-2-methylbut-2-enimidate |
|---|---|
| PubChem CID | 144784439 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [2-(difluoromethyl)-6-(methylamino)phenyl]methyl (Z)-4-imino-2-methylbut-2-enimidate |
| SMILES | [H]/N=C/C=C(C)\C(=N/[H])OCc1c(NC)cccc1C(F)F |
| InChI | InChI=1S/C14H17F2N3O/c1-9(6-7-17)14(18)20-8-11-10(13(15)16)4-3-5-12(11)19-2/h3-7,13,17-19H,8H2,1-2H3/b9-6-,17-7+,18-14+ |
| InChIKey | VJKISLKGRWFYRX-DZYGOXKHSA-N |
| XLogP | 3.76 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|