C12H12F2N5O2P — CID 144784442
1-[3-(difluoromethyl)-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]phenyl]-1-phosphorosohydrazine (PubChem CID 144784442) has the molecular formula C12H12F2N5O2P and a molecular weight of 327.23 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]phenyl]-1-phosphorosohydrazine.
| Compound Name | 1-[3-(difluoromethyl)-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]phenyl]-1-phosphorosohydrazine |
|---|---|
| PubChem CID | 144784442 |
| Molecular Formula | C12H12F2N5O2P |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 1-[3-(difluoromethyl)-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]phenyl]-1-phosphorosohydrazine |
| SMILES | Cc1ncnnc1OCc1c(C(F)F)cccc1N(N)P=O |
| InChI | InChI=1S/C12H12F2N5O2P/c1-7-12(18-17-6-16-7)21-5-9-8(11(13)14)3-2-4-10(9)19(15)22-20/h2-4,6,11H,5,15H2,1H3 |
| InChIKey | OAQLKKCBHKHGDE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|