About formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline
formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline (PubChem CID 144784598) has the molecular formula C15H18F3N5O2
and a molecular weight of 357.34 g/mol. Its IUPAC name is formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline |
| PubChem CID | 144784598 |
| Molecular Formula | C15H18F3N5O2 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline |
| SMILES | CNc1cccc(C(F)(F)F)c1COc1cncc(C)n1.NNC=O |
| InChI | InChI=1S/C14H14F3N3O.CH4N2O/c1-9-6-19-7-13(20-9)21-8-10-11(14(15,16)17)4-3-5-12(10)18-2;2-3-1-4/h3-7,18H,8H2,1-2H3;1H,2H2,(H,3,4) |
| InChIKey | DKUAFDFHGLTLPN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline?
The IUPAC name of formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline (CID 144784598) is formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline.
What is the SMILES notation for formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline?
The canonical SMILES for formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline is CNc1cccc(C(F)(F)F)c1COc1cncc(C)n1.NNC=O.
What is the InChIKey of formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline?
The InChIKey is DKUAFDFHGLTLPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3N3O.CH4N2O/c1-9-6-19-7-13(20-9)21-8-10-11(14(15,16)17)4-3-5-12(10)18-2;2-3-1-4/h3-7,18H,8H2,1-2H3;1H,2H2,(H,3,4).
What are the key properties of formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline?
formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline has a molecular weight of 357.34 g/mol, XLogP of 2.03, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for formohydrazide;N-methyl-2-[(6-methylpyrazin-2-yl)oxymethyl]-3-(trifluoromethyl)aniline is sourced from PubChem (CID 144784598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).