C16H20O2 — CID 14478580
(2S)-2-ethynyl-6-methoxy-2,5,7,8-tetramethyl-3,4-dihydrochromene (PubChem CID 14478580) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (2S)-2-ethynyl-6-methoxy-2,5,7,8-tetramethyl-3,4-dihydrochromene.
| Compound Name | (2S)-2-ethynyl-6-methoxy-2,5,7,8-tetramethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 14478580 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (2S)-2-ethynyl-6-methoxy-2,5,7,8-tetramethyl-3,4-dihydrochromene |
| SMILES | C#C[C@]1(C)CCc2c(C)c(OC)c(C)c(C)c2O1 |
| InChI | InChI=1S/C16H20O2/c1-7-16(5)9-8-13-12(4)14(17-6)10(2)11(3)15(13)18-16/h1H,8-9H2,2-6H3/t16-/m1/s1 |
| InChIKey | TVZJFSXMAVGQOK-MRXNPFEDSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|