C9H11NO2 — CID 144786677
3,4,7,8-tetrahydro-2H-1,4-benzoxazepin-5-one (PubChem CID 144786677) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 3,4,7,8-tetrahydro-2H-1,4-benzoxazepin-5-one.
| Compound Name | 3,4,7,8-tetrahydro-2H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 144786677 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3,4,7,8-tetrahydro-2H-1,4-benzoxazepin-5-one |
| SMILES | O=C1NCCOC2=CCCC=C12 |
| InChI | InChI=1S/C9H11NO2/c11-9-7-3-1-2-4-8(7)12-6-5-10-9/h3-4H,1-2,5-6H2,(H,10,11) |
| InChIKey | LVIICQWPRULHEI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |