About 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione
2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione (PubChem CID 14478701) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione.
Molecular Properties
| Compound Name | 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione |
| PubChem CID | 14478701 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione |
| SMILES | O=C1CC2CCCC3OC(=O)C1C23 |
| InChI | InChI=1S/C10H12O3/c11-6-4-5-2-1-3-7-8(5)9(6)10(12)13-7/h5,7-9H,1-4H2 |
| InChIKey | VNZYWEDHRWEDGB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione?
The IUPAC name of 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione (CID 14478701) is 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione.
What is the SMILES notation for 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione?
The canonical SMILES for 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione is O=C1CC2CCCC3OC(=O)C1C23.
What is the InChIKey of 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione?
The InChIKey is VNZYWEDHRWEDGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c11-6-4-5-2-1-3-7-8(5)9(6)10(12)13-7/h5,7-9H,1-4H2.
What are the key properties of 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione?
2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione has a molecular weight of 180.20 g/mol, XLogP of 0.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxatricyclo[5.3.1.04,11]undecane-3,5-dione is sourced from PubChem (CID 14478701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).