About methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate
methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate (PubChem CID 144787086) has the molecular formula C12H16N2O4
and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 144787086 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(/C=C/N(C)C)CCC([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C12H16N2O4/c1-13(2)7-6-9-4-5-10(14(16)17)8-11(9)12(15)18-3/h6-8H,4-5H2,1-3H3/b7-6+ |
| InChIKey | NBKBUEIRIXRBIU-VOTSOKGWSA-N |
| XLogP | 1.49 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate (CID 144787086) is methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate is COC(=O)C1=C(/C=C/N(C)C)CCC([N+](=O)[O-])=C1.
What is the InChIKey of methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate?
The InChIKey is NBKBUEIRIXRBIU-VOTSOKGWSA-N. The full InChI is InChI=1S/C12H16N2O4/c1-13(2)7-6-9-4-5-10(14(16)17)8-11(9)12(15)18-3/h6-8H,4-5H2,1-3H3/b7-6+.
What are the key properties of methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate?
methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate has a molecular weight of 252.27 g/mol, XLogP of 1.49, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(E)-2-(dimethylamino)ethenyl]-5-nitrocyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 144787086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).