C21H16F3N5OS2 — CID 144787091
4-[4,4-dimethyl-3-(3-methyl-2H-1,2,4-benzothiadiazin-7-yl)-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 144787091) has the molecular formula C21H16F3N5OS2 and a molecular weight of 475.52 g/mol. Its IUPAC name is 4-[4,4-dimethyl-3-(3-methyl-2H-1,2,4-benzothiadiazin-7-yl)-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4,4-dimethyl-3-(3-methyl-2H-1,2,4-benzothiadiazin-7-yl)-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 144787091 |
| Molecular Formula | C21H16F3N5OS2 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 4-[4,4-dimethyl-3-(3-methyl-2H-1,2,4-benzothiadiazin-7-yl)-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1=Nc2ccc(N3C(=S)N(c4ccc(C#N)c(C(F)(F)F)c4)C(=O)C3(C)C)cc2SN1 |
| InChI | InChI=1S/C21H16F3N5OS2/c1-11-26-16-7-6-14(9-17(16)32-27-11)29-19(31)28(18(30)20(29,2)3)13-5-4-12(10-25)15(8-13)21(22,23)24/h4-9H,1-3H3,(H,26,27) |
| InChIKey | JAUPZOIIFKIJQD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|