C10H12F3N — CID 144787939
(6E,8E)-8-(trifluoromethyl)-2,3,4,5-tetrahydroazecine (PubChem CID 144787939) has the molecular formula C10H12F3N and a molecular weight of 203.21 g/mol. Its IUPAC name is (6E,8E)-8-(trifluoromethyl)-2,3,4,5-tetrahydroazecine.
| Compound Name | (6E,8E)-8-(trifluoromethyl)-2,3,4,5-tetrahydroazecine |
|---|---|
| PubChem CID | 144787939 |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (6E,8E)-8-(trifluoromethyl)-2,3,4,5-tetrahydroazecine |
| SMILES | FC(F)(F)C1=C/C=N\CCCC\C=C\1 |
| InChI | InChI=1S/C10H12F3N/c11-10(12,13)9-5-3-1-2-4-7-14-8-6-9/h3,5-6,8H,1-2,4,7H2/b5-3+,9-6+,14-8- |
| InChIKey | JCCWNOBXFVPORE-FGEMICNDSA-N |
| XLogP | 3.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |