About N,N-diethyl-2,3-dimethylbutan-1-amine;ethane
N,N-diethyl-2,3-dimethylbutan-1-amine;ethane (PubChem CID 144788920) has the molecular formula C12H29N
and a molecular weight of 187.37 g/mol. Its IUPAC name is N,N-diethyl-2,3-dimethylbutan-1-amine;ethane.
Molecular Properties
| Compound Name | N,N-diethyl-2,3-dimethylbutan-1-amine;ethane |
| PubChem CID | 144788920 |
| Molecular Formula | C12H29N |
| Molecular Weight | 187.37 g/mol |
| Exact Mass | 187.23 |
| IUPAC Name | N,N-diethyl-2,3-dimethylbutan-1-amine;ethane |
| SMILES | CC.CCN(CC)CC(C)C(C)C |
| InChI | InChI=1S/C10H23N.C2H6/c1-6-11(7-2)8-10(5)9(3)4;1-2/h9-10H,6-8H2,1-5H3;1-2H3 |
| InChIKey | IXTJVXYNIOLENI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethyl-2,3-dimethylbutan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2,3-dimethylbutan-1-amine;ethane?
The IUPAC name of N,N-diethyl-2,3-dimethylbutan-1-amine;ethane (CID 144788920) is N,N-diethyl-2,3-dimethylbutan-1-amine;ethane.
What is the SMILES notation for N,N-diethyl-2,3-dimethylbutan-1-amine;ethane?
The canonical SMILES for N,N-diethyl-2,3-dimethylbutan-1-amine;ethane is CC.CCN(CC)CC(C)C(C)C.
What is the InChIKey of N,N-diethyl-2,3-dimethylbutan-1-amine;ethane?
The InChIKey is IXTJVXYNIOLENI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N.C2H6/c1-6-11(7-2)8-10(5)9(3)4;1-2/h9-10H,6-8H2,1-5H3;1-2H3.
What are the key properties of N,N-diethyl-2,3-dimethylbutan-1-amine;ethane?
N,N-diethyl-2,3-dimethylbutan-1-amine;ethane has a molecular weight of 187.37 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2,3-dimethylbutan-1-amine;ethane is sourced from PubChem (CID 144788920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).