C36H50N4O9S — CID 144789411
(3S)-4-[4-[3-[[4-(3-acetylsulfanyl-3-methylbutoxy)-4-methylpentanoyl]amino]propoxy]anilino]-3-[[2-[(3-methylbenzoyl)amino]acetyl]amino]-4-oxobutanoic acid (PubChem CID 144789411) has the molecular formula C36H50N4O9S and a molecular weight of 714.88 g/mol. Its IUPAC name is (3S)-4-[4-[3-[[4-(3-acetylsulfanyl-3-methylbutoxy)-4-methylpentanoyl]amino]propoxy]anilino]-3-[[2-[(3-methylbenzoyl)amino]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-[4-[3-[[4-(3-acetylsulfanyl-3-methylbutoxy)-4-methylpentanoyl]amino]propoxy]anilino]-3-[[2-[(3-methylbenzoyl)amino]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 144789411 |
| Molecular Formula | C36H50N4O9S |
| Molecular Weight | 714.88 g/mol |
| Exact Mass | 714.33 |
| IUPAC Name | (3S)-4-[4-[3-[[4-(3-acetylsulfanyl-3-methylbutoxy)-4-methylpentanoyl]amino]propoxy]anilino]-3-[[2-[(3-methylbenzoyl)amino]acetyl]amino]-4-oxobutanoic acid |
| SMILES | CC(=O)SC(C)(C)CCOC(C)(C)CCC(=O)NCCCOc1ccc(NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C36H50N4O9S/c1-24-9-7-10-26(21-24)33(46)38-23-31(43)40-29(22-32(44)45)34(47)39-27-11-13-28(14-12-27)48-19-8-18-37-30(42)15-16-35(3,4)49-20-17-36(5,6)50-25(2)41/h7,9-14,21,29H,8,15-20,22-23H2,1-6H3,(H,37,42)(H,38,46)(H,39,47)(H,40,43)(H,44,45)/t29-/m0/s1 |
| InChIKey | FUGINBZVYHUGBF-LJAQVGFWSA-N |
| XLogP | 4.23 |
| TPSA | 189.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.88 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|