C8H15NS — CID 144789943
(1E)-N,N,3-trimethyl-1-methylsulfanylbuta-1,3-dien-1-amine (PubChem CID 144789943) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is (1E)-N,N,3-trimethyl-1-methylsulfanylbuta-1,3-dien-1-amine.
| Compound Name | (1E)-N,N,3-trimethyl-1-methylsulfanylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144789943 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (1E)-N,N,3-trimethyl-1-methylsulfanylbuta-1,3-dien-1-amine |
| SMILES | C=C(C)/C=C(/SC)N(C)C |
| InChI | InChI=1S/C8H15NS/c1-7(2)6-8(10-5)9(3)4/h6H,1H2,2-5H3/b8-6+ |
| InChIKey | PNOWRGGAFOFJJF-SOFGYWHQSA-N |
| XLogP | 2.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|