C8H14N2S — CID 144789972
1,2-dihydropyridine-3-carbothioamide;ethane (PubChem CID 144789972) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 1,2-dihydropyridine-3-carbothioamide;ethane.
| Compound Name | 1,2-dihydropyridine-3-carbothioamide;ethane |
|---|---|
| PubChem CID | 144789972 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1,2-dihydropyridine-3-carbothioamide;ethane |
| SMILES | CC.NC(=S)C1=CC=CNC1 |
| InChI | InChI=1S/C6H8N2S.C2H6/c7-6(9)5-2-1-3-8-4-5;1-2/h1-3,8H,4H2,(H2,7,9);1-2H3 |
| InChIKey | ICKPKVCDAXNFOZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|