About 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine
1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine (PubChem CID 144789979) has the molecular formula C10H16N2S
and a molecular weight of 196.32 g/mol. Its IUPAC name is 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine.
Molecular Properties
| Compound Name | 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine |
| PubChem CID | 144789979 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine |
| SMILES | C=C(C)SC(NC)C1=CNCC=C1 |
| InChI | InChI=1S/C10H16N2S/c1-8(2)13-10(11-3)9-5-4-6-12-7-9/h4-5,7,10-12H,1,6H2,2-3H3 |
| InChIKey | FEBYIVXVJCQOBC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine?
The IUPAC name of 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine (CID 144789979) is 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine.
What is the SMILES notation for 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine?
The canonical SMILES for 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine is C=C(C)SC(NC)C1=CNCC=C1.
What is the InChIKey of 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine?
The InChIKey is FEBYIVXVJCQOBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S/c1-8(2)13-10(11-3)9-5-4-6-12-7-9/h4-5,7,10-12H,1,6H2,2-3H3.
What are the key properties of 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine?
1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine has a molecular weight of 196.32 g/mol, XLogP of 1.84, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dihydropyridin-5-yl)-N-methyl-1-prop-1-en-2-ylsulfanylmethanamine is sourced from PubChem (CID 144789979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).