About ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol
ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol (PubChem CID 144789993) has the molecular formula C8H15F3N2O
and a molecular weight of 212.21 g/mol. Its IUPAC name is ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol.
Molecular Properties
| Compound Name | ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol |
| PubChem CID | 144789993 |
| Molecular Formula | C8H15F3N2O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol |
| SMILES | CC.CCN1NC(C(F)(F)F)C=C1O |
| InChI | InChI=1S/C6H9F3N2O.C2H6/c1-2-11-5(12)3-4(10-11)6(7,8)9;1-2/h3-4,10,12H,2H2,1H3;1-2H3 |
| InChIKey | XXGZOIOIZNOAMN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol?
The IUPAC name of ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol (CID 144789993) is ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol.
What is the SMILES notation for ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol?
The canonical SMILES for ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol is CC.CCN1NC(C(F)(F)F)C=C1O.
What is the InChIKey of ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol?
The InChIKey is XXGZOIOIZNOAMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3N2O.C2H6/c1-2-11-5(12)3-4(10-11)6(7,8)9;1-2/h3-4,10,12H,2H2,1H3;1-2H3.
What are the key properties of ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol?
ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol has a molecular weight of 212.21 g/mol, XLogP of 2.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-5-(trifluoromethyl)-1,5-dihydropyrazol-3-ol is sourced from PubChem (CID 144789993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).