C12H17ClN2O4S — CID 144790086
4-chloro-2-nitroaniline;2,2-dimethylthiolane 1,1-dioxide (PubChem CID 144790086) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is 4-chloro-2-nitroaniline;2,2-dimethylthiolane 1,1-dioxide.
| Compound Name | 4-chloro-2-nitroaniline;2,2-dimethylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 144790086 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 4-chloro-2-nitroaniline;2,2-dimethylthiolane 1,1-dioxide |
| SMILES | CC1(C)CCCS1(=O)=O.Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5ClN2O2.C6H12O2S/c7-4-1-2-5(8)6(3-4)9(10)11;1-6(2)4-3-5-9(6,7)8/h1-3H,8H2;3-5H2,1-2H3 |
| InChIKey | MLFCSYMCWTYEBD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|