C15H23N3O — CID 144790249
N-(3-aminopropyl)-2-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]iminobut-3-enamide (PubChem CID 144790249) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]iminobut-3-enamide.
| Compound Name | N-(3-aminopropyl)-2-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]iminobut-3-enamide |
|---|---|
| PubChem CID | 144790249 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | N-(3-aminopropyl)-2-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]iminobut-3-enamide |
| SMILES | C=C/C=C\C(/N=C(/C=C)C(=O)NCCCN)=C(C)C |
| InChI | InChI=1S/C15H23N3O/c1-5-7-9-14(12(3)4)18-13(6-2)15(19)17-11-8-10-16/h5-7,9H,1-2,8,10-11,16H2,3-4H3,(H,17,19)/b9-7-,18-13+ |
| InChIKey | XQMSPNHBEIVHBG-FGQDEARFSA-N |
| XLogP | 2.11 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|