About 3,6-dimethylpyrimidin-4-one;ethane
3,6-dimethylpyrimidin-4-one;ethane (PubChem CID 144790420) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3,6-dimethylpyrimidin-4-one;ethane.
Molecular Properties
| Compound Name | 3,6-dimethylpyrimidin-4-one;ethane |
| PubChem CID | 144790420 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 3,6-dimethylpyrimidin-4-one;ethane |
| SMILES | CC.Cc1cc(=O)n(C)cn1 |
| InChI | InChI=1S/C6H8N2O.C2H6/c1-5-3-6(9)8(2)4-7-5;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | ZLZDRISEGJTIBR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-dimethylpyrimidin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethylpyrimidin-4-one;ethane?
The IUPAC name of 3,6-dimethylpyrimidin-4-one;ethane (CID 144790420) is 3,6-dimethylpyrimidin-4-one;ethane.
What is the SMILES notation for 3,6-dimethylpyrimidin-4-one;ethane?
The canonical SMILES for 3,6-dimethylpyrimidin-4-one;ethane is CC.Cc1cc(=O)n(C)cn1.
What is the InChIKey of 3,6-dimethylpyrimidin-4-one;ethane?
The InChIKey is ZLZDRISEGJTIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O.C2H6/c1-5-3-6(9)8(2)4-7-5;1-2/h3-4H,1-2H3;1-2H3.
What are the key properties of 3,6-dimethylpyrimidin-4-one;ethane?
3,6-dimethylpyrimidin-4-one;ethane has a molecular weight of 154.21 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethylpyrimidin-4-one;ethane is sourced from PubChem (CID 144790420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).