About 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole
5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole (PubChem CID 144791045) has the molecular formula C6H12FN3
and a molecular weight of 145.18 g/mol. Its IUPAC name is 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole.
Molecular Properties
| Compound Name | 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole |
| PubChem CID | 144791045 |
| Molecular Formula | C6H12FN3 |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.10 |
| IUPAC Name | 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole |
| SMILES | CN1C=C(CCCF)NN1 |
| InChI | InChI=1S/C6H12FN3/c1-10-5-6(8-9-10)3-2-4-7/h5,8-9H,2-4H2,1H3 |
| InChIKey | USILKRBIXFCUKY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole?
The IUPAC name of 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole (CID 144791045) is 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole.
What is the SMILES notation for 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole?
The canonical SMILES for 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole is CN1C=C(CCCF)NN1.
What is the InChIKey of 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole?
The InChIKey is USILKRBIXFCUKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12FN3/c1-10-5-6(8-9-10)3-2-4-7/h5,8-9H,2-4H2,1H3.
What are the key properties of 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole?
5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole has a molecular weight of 145.18 g/mol, XLogP of 0.53, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluoropropyl)-3-methyl-1,2-dihydrotriazole is sourced from PubChem (CID 144791045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).