About [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate
[3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 144792078) has the molecular formula C19H21F3O4S2
and a molecular weight of 434.50 g/mol. Its IUPAC name is [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate |
| PubChem CID | 144792078 |
| Molecular Formula | C19H21F3O4S2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | CSCCCOc1cc(C)c(-c2cccc(OS(=O)(=O)C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C19H21F3O4S2/c1-13-10-17(25-8-5-9-27-3)11-14(2)18(13)15-6-4-7-16(12-15)26-28(23,24)19(20,21)22/h4,6-7,10-12H,5,8-9H2,1-3H3 |
| InChIKey | LWMWVDVLARUGBU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate?
The IUPAC name of [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate (CID 144792078) is [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate?
The canonical SMILES for [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate is CSCCCOc1cc(C)c(-c2cccc(OS(=O)(=O)C(F)(F)F)c2)c(C)c1.
What is the InChIKey of [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate?
The InChIKey is LWMWVDVLARUGBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F3O4S2/c1-13-10-17(25-8-5-9-27-3)11-14(2)18(13)15-6-4-7-16(12-15)26-28(23,24)19(20,21)22/h4,6-7,10-12H,5,8-9H2,1-3H3.
What are the key properties of [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate?
[3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate has a molecular weight of 434.50 g/mol, XLogP of 5.33, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 144792078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).