C19H21F3O4S2 — CID 144792078
[3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 144792078) has the molecular formula C19H21F3O4S2 and a molecular weight of 434.50 g/mol. Its IUPAC name is [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 144792078 |
| Molecular Formula | C19H21F3O4S2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | [3-[2,6-dimethyl-4-(3-methylsulfanylpropoxy)phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | CSCCCOc1cc(C)c(-c2cccc(OS(=O)(=O)C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C19H21F3O4S2/c1-13-10-17(25-8-5-9-27-3)11-14(2)18(13)15-6-4-7-16(12-15)26-28(23,24)19(20,21)22/h4,6-7,10-12H,5,8-9H2,1-3H3 |
| InChIKey | LWMWVDVLARUGBU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|