About 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene
5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene (PubChem CID 144792520) has the molecular formula C11H12S
and a molecular weight of 176.28 g/mol. Its IUPAC name is 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene |
| PubChem CID | 144792520 |
| Molecular Formula | C11H12S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene |
| SMILES | C1=CC2CC2(C2=CCCS2)C=C1 |
| InChI | InChI=1S/C11H12S/c1-2-6-11(8-9(11)4-1)10-5-3-7-12-10/h1-2,4-6,9H,3,7-8H2 |
| InChIKey | DOVMKNVZZAAWDW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene?
The IUPAC name of 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene (CID 144792520) is 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene.
What is the SMILES notation for 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene?
The canonical SMILES for 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene is C1=CC2CC2(C2=CCCS2)C=C1.
What is the InChIKey of 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene?
The InChIKey is DOVMKNVZZAAWDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12S/c1-2-6-11(8-9(11)4-1)10-5-3-7-12-10/h1-2,4-6,9H,3,7-8H2.
What are the key properties of 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene?
5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene has a molecular weight of 176.28 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-bicyclo[4.1.0]hepta-2,4-dienyl)-2,3-dihydrothiophene is sourced from PubChem (CID 144792520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).