C22H19F3N4O4 — CID 144793412
methyl 1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]-5-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-3-carboxylate (PubChem CID 144793412) has the molecular formula C22H19F3N4O4 and a molecular weight of 460.41 g/mol. Its IUPAC name is methyl 1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]-5-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-3-carboxylate.
| Compound Name | methyl 1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]-5-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 144793412 |
| Molecular Formula | C22H19F3N4O4 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | methyl 1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]-5-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-3-carboxylate |
| SMILES | COC(=O)c1nn(-c2cc(C#C[C@H](O)CCN(C)C=O)cc(C(F)(F)F)c2)c2ncccc12 |
| InChI | InChI=1S/C22H19F3N4O4/c1-28(13-30)9-7-17(31)6-5-14-10-15(22(23,24)25)12-16(11-14)29-20-18(4-3-8-26-20)19(27-29)21(32)33-2/h3-4,8,10-13,17,31H,7,9H2,1-2H3/t17-/m0/s1 |
| InChIKey | RXYOQWBPPCTYTK-KRWDZBQOSA-N |
| XLogP | 2.42 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|