C16H17ClN4O — CID 144793484
5-(chloromethyl)-1-(4-methyl-2-pyridinyl)indazole-3-carboxamide;methane (PubChem CID 144793484) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is 5-(chloromethyl)-1-(4-methyl-2-pyridinyl)indazole-3-carboxamide;methane.
| Compound Name | 5-(chloromethyl)-1-(4-methyl-2-pyridinyl)indazole-3-carboxamide;methane |
|---|---|
| PubChem CID | 144793484 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 5-(chloromethyl)-1-(4-methyl-2-pyridinyl)indazole-3-carboxamide;methane |
| SMILES | C.Cc1ccnc(-n2nc(C(N)=O)c3cc(CCl)ccc32)c1 |
| InChI | InChI=1S/C15H13ClN4O.CH4/c1-9-4-5-18-13(6-9)20-12-3-2-10(8-16)7-11(12)14(19-20)15(17)21;/h2-7H,8H2,1H3,(H2,17,21);1H4 |
| InChIKey | OOAWPUHXCOFLHA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|