C22H20N4O3 — CID 144794141
ethyl 8-[3-[2-(1-methyl-2-oxopyrrolidin-3-yl)ethynyl]phenyl]imidazo[1,2-a]pyrazine-6-carboxylate (PubChem CID 144794141) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is ethyl 8-[3-[2-(1-methyl-2-oxopyrrolidin-3-yl)ethynyl]phenyl]imidazo[1,2-a]pyrazine-6-carboxylate.
| Compound Name | ethyl 8-[3-[2-(1-methyl-2-oxopyrrolidin-3-yl)ethynyl]phenyl]imidazo[1,2-a]pyrazine-6-carboxylate |
|---|---|
| PubChem CID | 144794141 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | ethyl 8-[3-[2-(1-methyl-2-oxopyrrolidin-3-yl)ethynyl]phenyl]imidazo[1,2-a]pyrazine-6-carboxylate |
| SMILES | CCOC(=O)c1cn2ccnc2c(-c2cccc(C#CC3CCN(C)C3=O)c2)n1 |
| InChI | InChI=1S/C22H20N4O3/c1-3-29-22(28)18-14-26-12-10-23-20(26)19(24-18)17-6-4-5-15(13-17)7-8-16-9-11-25(2)21(16)27/h4-6,10,12-14,16H,3,9,11H2,1-2H3 |
| InChIKey | LUELZPAECKFKEL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|