C17H19N3S — CID 144794169
5-[(1E)-1-(methylideneamino)-1-phenylbuta-1,3-dien-2-yl]-N-propyl-1,3-thiazol-2-amine (PubChem CID 144794169) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 5-[(1E)-1-(methylideneamino)-1-phenylbuta-1,3-dien-2-yl]-N-propyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(1E)-1-(methylideneamino)-1-phenylbuta-1,3-dien-2-yl]-N-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 144794169 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 5-[(1E)-1-(methylideneamino)-1-phenylbuta-1,3-dien-2-yl]-N-propyl-1,3-thiazol-2-amine |
| SMILES | C=C/C(=C(\N=C)c1ccccc1)c1cnc(NCCC)s1 |
| InChI | InChI=1S/C17H19N3S/c1-4-11-19-17-20-12-15(21-17)14(5-2)16(18-3)13-9-7-6-8-10-13/h5-10,12H,2-4,11H2,1H3,(H,19,20)/b16-14+ |
| InChIKey | OJTHQPAAURMKGZ-JQIJEIRASA-N |
| XLogP | 4.72 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|