C15H16BrNOS — CID 144794180
2-bromo-5-[(E)-2-cyclohepta-1,3,5,6-tetraen-1-yl-2-methoxyethenyl]-1,3-thiazole;ethane (PubChem CID 144794180) has the molecular formula C15H16BrNOS and a molecular weight of 338.27 g/mol. Its IUPAC name is 2-bromo-5-[(E)-2-cyclohepta-1,3,5,6-tetraen-1-yl-2-methoxyethenyl]-1,3-thiazole;ethane.
| Compound Name | 2-bromo-5-[(E)-2-cyclohepta-1,3,5,6-tetraen-1-yl-2-methoxyethenyl]-1,3-thiazole;ethane |
|---|---|
| PubChem CID | 144794180 |
| Molecular Formula | C15H16BrNOS |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 2-bromo-5-[(E)-2-cyclohepta-1,3,5,6-tetraen-1-yl-2-methoxyethenyl]-1,3-thiazole;ethane |
| SMILES | CC.CO/C(=C/c1cnc(Br)s1)C1=CC=CC=C=C1 |
| InChI | InChI=1S/C13H10BrNOS.C2H6/c1-16-12(8-11-9-15-13(14)17-11)10-6-4-2-3-5-7-10;1-2/h2-4,6-9H,1H3;1-2H3/b12-8+; |
| InChIKey | UWDUBYMYQRCJKG-MXZHIVQLSA-N |
| XLogP | 5.13 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|