C13H10BrNOS — CID 144794181
2-bromo-5-[(E)-2-cyclohepta-1,3,5,6-tetraen-1-yl-2-methoxyethenyl]-1,3-thiazole (PubChem CID 144794181) has the molecular formula C13H10BrNOS and a molecular weight of 308.20 g/mol. Its IUPAC name is 2-bromo-5-[(E)-2-cyclohepta-1,3,5,6-tetraen-1-yl-2-methoxyethenyl]-1,3-thiazole.
| Compound Name | 2-bromo-5-[(E)-2-cyclohepta-1,3,5,6-tetraen-1-yl-2-methoxyethenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 144794181 |
| Molecular Formula | C13H10BrNOS |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | 2-bromo-5-[(E)-2-cyclohepta-1,3,5,6-tetraen-1-yl-2-methoxyethenyl]-1,3-thiazole |
| SMILES | CO/C(=C/c1cnc(Br)s1)C1=CC=CC=C=C1 |
| InChI | InChI=1S/C13H10BrNOS/c1-16-12(8-11-9-15-13(14)17-11)10-6-4-2-3-5-7-10/h2-4,6-9H,1H3/b12-8+ |
| InChIKey | CIZHYGLHBGFJHV-XYOKQWHBSA-N |
| XLogP | 4.10 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|