C24H29ClN8O4 — CID 144794206
tert-butyl 4-[4-[[5-chloro-4-(3-nitroanilino)pyrimidin-2-yl]-methylamino]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 144794206) has the molecular formula C24H29ClN8O4 and a molecular weight of 529.00 g/mol. Its IUPAC name is tert-butyl 4-[4-[[5-chloro-4-(3-nitroanilino)pyrimidin-2-yl]-methylamino]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[5-chloro-4-(3-nitroanilino)pyrimidin-2-yl]-methylamino]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 144794206 |
| Molecular Formula | C24H29ClN8O4 |
| Molecular Weight | 529.00 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | tert-butyl 4-[4-[[5-chloro-4-(3-nitroanilino)pyrimidin-2-yl]-methylamino]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CN(c1cnn(C2CCN(C(=O)OC(C)(C)C)CC2)c1)c1ncc(Cl)c(Nc2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C24H29ClN8O4/c1-24(2,3)37-23(34)31-10-8-17(9-11-31)32-15-19(13-27-32)30(4)22-26-14-20(25)21(29-22)28-16-6-5-7-18(12-16)33(35)36/h5-7,12-15,17H,8-11H2,1-4H3,(H,26,28,29) |
| InChIKey | WFJSWFHSLWKECP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.00 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|