C10H17NO — CID 144794263
(2Z,4Z,6Z)-5-(ethylamino)octa-2,4,6-trien-4-ol (PubChem CID 144794263) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (2Z,4Z,6Z)-5-(ethylamino)octa-2,4,6-trien-4-ol.
| Compound Name | (2Z,4Z,6Z)-5-(ethylamino)octa-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 144794263 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2Z,4Z,6Z)-5-(ethylamino)octa-2,4,6-trien-4-ol |
| SMILES | C/C=C\C(O)=C(/C=C\C)NCC |
| InChI | InChI=1S/C10H17NO/c1-4-7-9(11-6-3)10(12)8-5-2/h4-5,7-8,11-12H,6H2,1-3H3/b7-4-,8-5-,10-9- |
| InChIKey | JVVFVPDFMCZIGM-NOHNPUCESA-N |
| XLogP | 2.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|