C28H33NO2S — CID 144794415
5-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-4-methyl-2-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)-4H-thiopyran (PubChem CID 144794415) has the molecular formula C28H33NO2S and a molecular weight of 447.64 g/mol. Its IUPAC name is 5-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-4-methyl-2-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)-4H-thiopyran.
| Compound Name | 5-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-4-methyl-2-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)-4H-thiopyran |
|---|---|
| PubChem CID | 144794415 |
| Molecular Formula | C28H33NO2S |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 5-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-4-methyl-2-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)-4H-thiopyran |
| SMILES | Cc1cc(CC2=CSC(c3ccc4c(c3)CCCCC4)=CC2C)c(C)cc1CC[N+](=O)[O-] |
| InChI | InChI=1S/C28H33NO2S/c1-19-14-26(20(2)13-23(19)11-12-29(30)31)17-27-18-32-28(15-21(27)3)25-10-9-22-7-5-4-6-8-24(22)16-25/h9-10,13-16,18,21H,4-8,11-12,17H2,1-3H3 |
| InChIKey | HEZBLTITJOFEQU-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|