C28H35NO2S — CID 144794485
6-[(Z)-1-[(E)-3-[2,5-dimethyl-4-(2-nitroethyl)phenyl]-2-methylprop-1-enyl]sulfanylbut-1-enyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 144794485) has the molecular formula C28H35NO2S and a molecular weight of 449.66 g/mol. Its IUPAC name is 6-[(Z)-1-[(E)-3-[2,5-dimethyl-4-(2-nitroethyl)phenyl]-2-methylprop-1-enyl]sulfanylbut-1-enyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[(Z)-1-[(E)-3-[2,5-dimethyl-4-(2-nitroethyl)phenyl]-2-methylprop-1-enyl]sulfanylbut-1-enyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 144794485 |
| Molecular Formula | C28H35NO2S |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 6-[(Z)-1-[(E)-3-[2,5-dimethyl-4-(2-nitroethyl)phenyl]-2-methylprop-1-enyl]sulfanylbut-1-enyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC/C=C(\S/C=C(\C)Cc1cc(C)c(CC[N+](=O)[O-])cc1C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C28H35NO2S/c1-5-8-28(26-12-11-23-9-6-7-10-25(23)18-26)32-19-20(2)15-27-17-21(3)24(16-22(27)4)13-14-29(30)31/h8,11-12,16-19H,5-7,9-10,13-15H2,1-4H3/b20-19+,28-8- |
| InChIKey | QDDIXGUJUBLQHM-PZCQGDQYSA-N |
| XLogP | 7.63 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|