About 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline
4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline (PubChem CID 144794537) has the molecular formula C12H13FN2S
and a molecular weight of 236.31 g/mol. Its IUPAC name is 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline.
Molecular Properties
| Compound Name | 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline |
| PubChem CID | 144794537 |
| Molecular Formula | C12H13FN2S |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline |
| SMILES | Cc1cc(Cc2csc(F)n2)c(C)cc1N |
| InChI | InChI=1S/C12H13FN2S/c1-7-4-11(14)8(2)3-9(7)5-10-6-16-12(13)15-10/h3-4,6H,5,14H2,1-2H3 |
| InChIKey | NRYBUSRXENODIY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline?
The IUPAC name of 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline (CID 144794537) is 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline.
What is the SMILES notation for 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline?
The canonical SMILES for 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline is Cc1cc(Cc2csc(F)n2)c(C)cc1N.
What is the InChIKey of 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline?
The InChIKey is NRYBUSRXENODIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2S/c1-7-4-11(14)8(2)3-9(7)5-10-6-16-12(13)15-10/h3-4,6H,5,14H2,1-2H3.
What are the key properties of 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline?
4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline has a molecular weight of 236.31 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-fluoro-1,3-thiazol-4-yl)methyl]-2,5-dimethylaniline is sourced from PubChem (CID 144794537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).