C29H35F2N3S — CID 144794635
3-[4-[[2-(2,4-difluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)-1,3-thiazol-4-yl]methyl]-2,5-dimethylphenyl]imino-N-ethyl-N-methylpropan-1-amine (PubChem CID 144794635) has the molecular formula C29H35F2N3S and a molecular weight of 495.68 g/mol. Its IUPAC name is 3-[4-[[2-(2,4-difluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)-1,3-thiazol-4-yl]methyl]-2,5-dimethylphenyl]imino-N-ethyl-N-methylpropan-1-amine.
| Compound Name | 3-[4-[[2-(2,4-difluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)-1,3-thiazol-4-yl]methyl]-2,5-dimethylphenyl]imino-N-ethyl-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 144794635 |
| Molecular Formula | C29H35F2N3S |
| Molecular Weight | 495.68 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 3-[4-[[2-(2,4-difluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)-1,3-thiazol-4-yl]methyl]-2,5-dimethylphenyl]imino-N-ethyl-N-methylpropan-1-amine |
| SMILES | CCN(C)CC/C=N/c1cc(C)c(Cc2csc(-c3c(F)cc4c(c3F)CCCCC4)n2)cc1C |
| InChI | InChI=1S/C29H35F2N3S/c1-5-34(4)13-9-12-32-26-15-19(2)22(14-20(26)3)16-23-18-35-29(33-23)27-25(30)17-21-10-7-6-8-11-24(21)28(27)31/h12,14-15,17-18H,5-11,13,16H2,1-4H3/b32-12+ |
| InChIKey | LNPRRDHYRMMJOD-DPWJMMOYSA-N |
| XLogP | 7.61 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.68 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|