C26H29NO2S — CID 144794679
5-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-4H-thiopyran (PubChem CID 144794679) has the molecular formula C26H29NO2S and a molecular weight of 419.59 g/mol. Its IUPAC name is 5-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-4H-thiopyran.
| Compound Name | 5-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-4H-thiopyran |
|---|---|
| PubChem CID | 144794679 |
| Molecular Formula | C26H29NO2S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 5-[[2,5-dimethyl-4-(2-nitroethyl)phenyl]methyl]-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-4H-thiopyran |
| SMILES | Cc1cc(CC2=CSC(c3cccc4c3CCCC4)=CC2)c(C)cc1CC[N+](=O)[O-] |
| InChI | InChI=1S/C26H29NO2S/c1-18-15-23(19(2)14-22(18)12-13-27(28)29)16-20-10-11-26(30-17-20)25-9-5-7-21-6-3-4-8-24(21)25/h5,7,9,11,14-15,17H,3-4,6,8,10,12-13,16H2,1-2H3 |
| InChIKey | SBZIZTRHOQYLEU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|