About 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline
4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline (PubChem CID 144795005) has the molecular formula C21H24FNS
and a molecular weight of 341.50 g/mol. Its IUPAC name is 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline.
Molecular Properties
| Compound Name | 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline |
| PubChem CID | 144795005 |
| Molecular Formula | C21H24FNS |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline |
| SMILES | C=C(S/C=C(\C)Cc1cc(C)c(N)cc1C)c1ccc(C)cc1F |
| InChI | InChI=1S/C21H24FNS/c1-13-6-7-19(20(22)9-13)17(5)24-12-14(2)8-18-10-16(4)21(23)11-15(18)3/h6-7,9-12H,5,8,23H2,1-4H3/b14-12+ |
| InChIKey | LDENCBWSVMFHJR-WYMLVPIESA-N |
| XLogP | 6.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline?
The IUPAC name of 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline (CID 144795005) is 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline.
What is the SMILES notation for 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline?
The canonical SMILES for 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline is C=C(S/C=C(\C)Cc1cc(C)c(N)cc1C)c1ccc(C)cc1F.
What is the InChIKey of 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline?
The InChIKey is LDENCBWSVMFHJR-WYMLVPIESA-N. The full InChI is InChI=1S/C21H24FNS/c1-13-6-7-19(20(22)9-13)17(5)24-12-14(2)8-18-10-16(4)21(23)11-15(18)3/h6-7,9-12H,5,8,23H2,1-4H3/b14-12+.
What are the key properties of 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline?
4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline has a molecular weight of 341.50 g/mol, XLogP of 6.18, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-3-[1-(2-fluoro-4-methylphenyl)ethenylsulfanyl]-2-methylprop-2-enyl]-2,5-dimethylaniline is sourced from PubChem (CID 144795005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).