C24H26F3N3S — CID 144795047
N'-[2-[2,5-dimethyl-4-[[2-(2,4,6-trifluorophenyl)-1,3-thiazol-4-yl]methyl]phenyl]ethyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 144795047) has the molecular formula C24H26F3N3S and a molecular weight of 445.55 g/mol. Its IUPAC name is N'-[2-[2,5-dimethyl-4-[[2-(2,4,6-trifluorophenyl)-1,3-thiazol-4-yl]methyl]phenyl]ethyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-[2,5-dimethyl-4-[[2-(2,4,6-trifluorophenyl)-1,3-thiazol-4-yl]methyl]phenyl]ethyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 144795047 |
| Molecular Formula | C24H26F3N3S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N'-[2-[2,5-dimethyl-4-[[2-(2,4,6-trifluorophenyl)-1,3-thiazol-4-yl]methyl]phenyl]ethyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/CCc1cc(C)c(Cc2csc(-c3c(F)cc(F)cc3F)n2)cc1C |
| InChI | InChI=1S/C24H26F3N3S/c1-5-30(4)14-28-7-6-17-8-16(3)18(9-15(17)2)10-20-13-31-24(29-20)23-21(26)11-19(25)12-22(23)27/h8-9,11-14H,5-7,10H2,1-4H3/b28-14+ |
| InChIKey | LZDJYFHFMKKQLT-CCVNUDIWSA-N |
| XLogP | 5.96 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|