C30H42OS — CID 144795067
ethane;3-(1-methylsulfanylethenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-one;1,2,3,5-tetramethyl-4-(2-methylprop-2-enyl)benzene (PubChem CID 144795067) has the molecular formula C30H42OS and a molecular weight of 450.73 g/mol. Its IUPAC name is ethane;3-(1-methylsulfanylethenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-one;1,2,3,5-tetramethyl-4-(2-methylprop-2-enyl)benzene.
| Compound Name | ethane;3-(1-methylsulfanylethenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-one;1,2,3,5-tetramethyl-4-(2-methylprop-2-enyl)benzene |
|---|---|
| PubChem CID | 144795067 |
| Molecular Formula | C30H42OS |
| Molecular Weight | 450.73 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | ethane;3-(1-methylsulfanylethenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-one;1,2,3,5-tetramethyl-4-(2-methylprop-2-enyl)benzene |
| SMILES | C=C(C)Cc1c(C)cc(C)c(C)c1C.C=C(SC)c1ccc2c(c1)C(=O)CCCC2.CC |
| InChI | InChI=1S/C14H16OS.C14H20.C2H6/c1-10(16-2)12-8-7-11-5-3-4-6-14(15)13(11)9-12;1-9(2)7-14-11(4)8-10(3)12(5)13(14)6;1-2/h7-9H,1,3-6H2,2H3;8H,1,7H2,2-6H3;1-2H3 |
| InChIKey | AZVWPUALELNBML-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.73 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|