C15H23NO — CID 144795148
ethane;4-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-2-propan-2-yl-1,3-oxazole (PubChem CID 144795148) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is ethane;4-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-2-propan-2-yl-1,3-oxazole.
| Compound Name | ethane;4-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-2-propan-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 144795148 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | ethane;4-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-2-propan-2-yl-1,3-oxazole |
| SMILES | C=C/C(C)=C\C(=C)c1coc(C(C)C)n1.CC |
| InChI | InChI=1S/C13H17NO.C2H6/c1-6-10(4)7-11(5)12-8-15-13(14-12)9(2)3;1-2/h6-9H,1,5H2,2-4H3;1-2H3/b10-7-; |
| InChIKey | YDVVOCQFNZWIKO-VEZAGKLZSA-N |
| XLogP | 4.97 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|